Enthalpy and Entropy of Formation

 

Enthalpy and Entropy of Formation

Enthalpy and entropy are both crucial concepts in thermodynamics. They play significant roles in understanding chemical reactions, particularly in the context of enthalpy of formation and entropy of formation. Let's break them down and discuss in detail.


1. Enthalpy of Formation

Enthalpy is the heat content of a system at constant pressure. It is defined as the sum of the internal energy and the product of pressure and volume. The enthalpy of formation (ΔHf\Delta H_f^\circ) refers to the change in enthalpy when one mole of a compound is formed from its elements in their standard states.

  • Standard State: The most stable form of a substance at 1 bar (or 1 atm) and 25°C (298 K).

The general equation for the enthalpy of formation is:

Reaction: A+BC\text{Reaction: } A + B \rightarrow C ΔHf(C)=ΔH(Products)ΔH(Reactants)\Delta H_f^\circ (\text{C}) = \Delta H (\text{Products}) - \Delta H (\text{Reactants})
Example: Formation of Water

For the formation of water (H2OH_2O) from hydrogen and oxygen:

H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2} O_2(g) \rightarrow H_2O(l)

The enthalpy of formation for water:

ΔHf(H2O)=241.8kJ/mol\Delta H_f^\circ (\text{H}_2\text{O}) = -241.8 \, \text{kJ/mol}

This means that when 1 mole of water is formed from hydrogen and oxygen, 241.8 kJ of energy is released (exothermic reaction).

Key Points:
  • Enthalpy of formation is zero for elements in their most stable form. For example, ΔHf(O2)=0\Delta H_f^\circ (\text{O}_2) = 0.
  • It is always measured under standard conditions (298 K, 1 atm).

2. Entropy of Formation

Entropy (SS) is a measure of the disorder or randomness of a system. The entropy of formation (ΔSf\Delta S_f^\circ) refers to the change in entropy when 1 mole of a compound is formed from its elements in their standard states.

The entropy of a substance increases with its molecular complexity and state (gas > liquid > solid). Just like enthalpy, entropy values are often tabulated for standard conditions (298 K, 1 atm).

Example: Entropy of Water Formation

The formation of water from hydrogen and oxygen also involves a change in entropy. In the reaction:

H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2} O_2(g) \rightarrow H_2O(l)
  • Entropy of formation for water is negative because a gas (H₂ and O₂) is converted into a liquid (H₂O), which has less disorder.

For example:

ΔSf(H2O)=69.91J/mol\cdotpK\Delta S_f^\circ (\text{H}_2\text{O}) = -69.91 \, \text{J/mol·K}

This indicates a decrease in entropy because the system becomes more ordered as a gas transitions to a liquid.

Key Points:
  • Entropy of formation is positive if a system moves from a less ordered to a more ordered state.
  • It is negative if a system moves from a more ordered to a less ordered state (e.g., gas to liquid).

3. Mathematical Terms and Relationships

First Law of Thermodynamics (Conservation of Energy): The change in internal energy (ΔU\Delta U) is related to heat (qq) and work (WW):

ΔU=q+W\Delta U = q + W

For constant pressure reactions, the change in enthalpy (ΔH\Delta H) equals the heat added to the system:

ΔH=qp\Delta H = q_p

Second Law of Thermodynamics: The entropy of an isolated system will tend to increase, or remain constant in an ideal process:

ΔSuniverse=ΔSsystem+ΔSsurroundings>0\Delta S_{\text{universe}} = \Delta S_{\text{system}} + \Delta S_{\text{surroundings}} > 0

This law helps in predicting the spontaneity of a reaction.

Gibbs Free Energy (ΔG\Delta G) is related to enthalpy and entropy:

ΔG=ΔHTΔS\Delta G = \Delta H - T \Delta S

Where:

  • ΔG\Delta G = change in Gibbs free energy
  • TT = temperature in Kelvin
  • ΔH\Delta H = change in enthalpy
  • ΔS\Delta S = change in entropy

4. Important Relations and Examples

  • Enthalpy and Entropy Changes in Combustion:

Combustion reactions are often studied in terms of enthalpy and entropy changes. For example, the combustion of methane:

CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l)

The enthalpy change is negative, indicating an exothermic reaction, and the entropy change is positive as gaseous products are formed from gaseous reactants.


Multiple Choice Questions (MCQ)

  1. What is the enthalpy of formation for elemental oxygen at standard conditions? a) 0
    b) 1
    c) -1
    d) Undefined
    Answer: a) 0

  2. Which of the following is true for the entropy of formation? a) It is always positive for all substances
    b) It is always zero for pure elements in their standard states
    c) It is negative for gases
    d) It is irrelevant to chemical reactions
    Answer: b) It is always zero for pure elements in their standard states

  3. The standard enthalpy of formation of water is: a) 0 kJ/mol
    b) -241.8 kJ/mol
    c) +241.8 kJ/mol
    d) -1 kJ/mol
    Answer: b) -241.8 kJ/mol

  4. Which of the following reactions is exothermic? a) Melting of ice
    b) Condensation of water
    c) Evaporation of water
    d) Dissolving of salt in water
    Answer: b) Condensation of water

  5. Which condition describes an increase in entropy? a) Gas to liquid
    b) Solid to liquid
    c) Liquid to solid
    d) Liquid to gas
    Answer: d) Liquid to gas

  6. The standard entropy change for a reaction is calculated as: a) Entropy of products minus entropy of reactants
    b) Entropy of reactants minus entropy of products
    c) Zero
    d) The sum of all reactant entropies
    Answer: a) Entropy of products minus entropy of reactants

  7. What happens to the entropy during combustion? a) It decreases
    b) It increases
    c) It remains constant
    d) It is unpredictable
    Answer: b) It increases

  8. Which of the following best describes a spontaneous reaction? a) Positive ΔG\Delta G
    b) Negative ΔH\Delta H
    c) Positive ΔS\Delta S
    d) Negative ΔG\Delta G
    Answer: d) Negative ΔG\Delta G

  9. For the formation of a gas from a liquid, the entropy change is typically: a) Negative
    b) Positive
    c) Zero
    d) Undefined
    Answer: b) Positive

  10. What is the unit of standard enthalpy of formation? a) Joules
    b) Kilojoules per mole
    c) Kilocalories
    d) Joules per gram
    Answer: b) Kilojoules per mole


Short and Long Questions

  1. What is the relationship between enthalpy of formation and standard enthalpy of reaction? Answer: The standard enthalpy of a reaction can be calculated by summing the standard enthalpies of formation of the products and subtracting the standard enthalpies of formation of the reactants:
ΔHreaction=ΔHf(products)ΔHf(reactants)\Delta H_{\text{reaction}}^\circ = \sum \Delta H_f^\circ (\text{products}) - \sum \Delta H_f^\circ (\text{reactants})
  1. How do changes in entropy affect the spontaneity of a chemical reaction? Answer: Changes in entropy (ΔS\Delta S) affect spontaneity when combined with enthalpy changes. A positive ΔS\Delta S favors spontaneity, especially when the reaction is exothermic (negative ΔH\Delta H). The Gibbs free energy equation (ΔG=ΔHTΔS\Delta G = \Delta H - T \Delta S) indicates that a reaction is spontaneous if ΔG\Delta G is negative.

  2. Why is the enthalpy of formation of an element in its standard state zero? Answer: The enthalpy of formation of an element in its standard state is zero by definition. This is because it is assumed that the element is already in its most stable form under standard conditions, and no energy is required to form it.

  3. How is entropy related to the disorder of a system? Answer: Entropy is a measure of the disorder or randomness in a system. A higher entropy value indicates a more disordered system, while a lower value indicates more order. For example, gases have higher entropy than liquids, which in turn have higher entropy than solids.

  4. Explain how the concept of entropy is applied in the formation of water from hydrogen and oxygen. Answer: The formation of water from hydrogen and oxygen results in a decrease in entropy. This is because the two gases (hydrogen and oxygen) are transformed into a liquid (water), which is more ordered than the gaseous state. Therefore, ΔS\Delta S for this reaction is negative.

Share this post with friends

Previous Post Next Post
No one has commented on this post yet
Comments Here

Follow Top Trending Privacy Policy and comments

comment url